About 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene
1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene (PubChem CID 142480467) has the molecular formula C26H30
and a molecular weight of 342.53 g/mol. Its IUPAC name is 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene.
Molecular Properties
| Compound Name | 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene |
| PubChem CID | 142480467 |
| Molecular Formula | C26H30 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene |
| SMILES | C=Cc1cccc(Cc2ccccc2CC)c1C.CCc1ccccc1 |
| InChI | InChI=1S/C18H20.C8H10/c1-4-15-11-8-12-17(14(15)3)13-18-10-7-6-9-16(18)5-2;1-2-8-6-4-3-5-7-8/h4,6-12H,1,5,13H2,2-3H3;3-7H,2H2,1H3 |
| InChIKey | ZPPACAGRXFMSLE-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene?
The IUPAC name of 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene (CID 142480467) is 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene.
What is the SMILES notation for 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene?
The canonical SMILES for 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene is C=Cc1cccc(Cc2ccccc2CC)c1C.CCc1ccccc1.
What is the InChIKey of 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene?
The InChIKey is ZPPACAGRXFMSLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20.C8H10/c1-4-15-11-8-12-17(14(15)3)13-18-10-7-6-9-16(18)5-2;1-2-8-6-4-3-5-7-8/h4,6-12H,1,5,13H2,2-3H3;3-7H,2H2,1H3.
What are the key properties of 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene?
1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene has a molecular weight of 342.53 g/mol, XLogP of 7.04, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3-[(2-ethylphenyl)methyl]-2-methylbenzene;ethylbenzene is sourced from PubChem (CID 142480467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).