C16H30N2S — CID 142488130
4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-1-N,1-N,3-N-trimethylbutane-1,3-diamine;prop-1-ene (PubChem CID 142488130) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-1-N,1-N,3-N-trimethylbutane-1,3-diamine;prop-1-ene.
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-1-N,1-N,3-N-trimethylbutane-1,3-diamine;prop-1-ene |
|---|---|
| PubChem CID | 142488130 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-1-N,1-N,3-N-trimethylbutane-1,3-diamine;prop-1-ene |
| SMILES | C=C/C=C(\C=C)SCC(CCN(C)C)NC.C=CC |
| InChI | InChI=1S/C13H24N2S.C3H6/c1-6-8-13(7-2)16-11-12(14-3)9-10-15(4)5;1-3-2/h6-8,12,14H,1-2,9-11H2,3-5H3;3H,1H2,2H3/b13-8+; |
| InChIKey | LQGKVHAZHAIERH-FNXZNAJJSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|