C11H19NS — CID 142873329
1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]sulfanyl-N-methylpropan-2-amine (PubChem CID 142873329) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is 1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]sulfanyl-N-methylpropan-2-amine.
| Compound Name | 1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]sulfanyl-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 142873329 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]sulfanyl-N-methylpropan-2-amine |
| SMILES | C=C(/C=C\C=C/C)SCC(C)NC |
| InChI | InChI=1S/C11H19NS/c1-5-6-7-8-11(3)13-9-10(2)12-4/h5-8,10,12H,3,9H2,1-2,4H3/b6-5-,8-7- |
| InChIKey | HCKSIBXLMWKPNQ-ISTTXYCBSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|