C13H25NS — CID 156645077
ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-N-methylbutan-1-amine (PubChem CID 156645077) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-N-methylbutan-1-amine.
| Compound Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 156645077 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-N-methylbutan-1-amine |
| SMILES | C=C/C=C(\C=C)SCCCCNC.CC |
| InChI | InChI=1S/C11H19NS.C2H6/c1-4-8-11(5-2)13-10-7-6-9-12-3;1-2/h4-5,8,12H,1-2,6-7,9-10H2,3H3;1-2H3/b11-8+; |
| InChIKey | WYENWVFGDXQPGC-YGCVIUNWSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|