C9H15NS — CID 163480350
(2R)-1-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpropan-2-amine (PubChem CID 163480350) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is (2R)-1-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpropan-2-amine.
| Compound Name | (2R)-1-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 163480350 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (2R)-1-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpropan-2-amine |
| SMILES | C=C/C=C(\C=C)SC[C@@H](C)N |
| InChI | InChI=1S/C9H15NS/c1-4-6-9(5-2)11-7-8(3)10/h4-6,8H,1-2,7,10H2,3H3/b9-6+/t8-/m1/s1 |
| InChIKey | CDZZVGPSVGIWLO-GTUWVTDSSA-N |
| XLogP | 2.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|