C12H20N2OS — CID 143645715
3-amino-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-N,N-dimethylbutanamide (PubChem CID 143645715) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 3-amino-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-N,N-dimethylbutanamide.
| Compound Name | 3-amino-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 143645715 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-amino-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanyl-N,N-dimethylbutanamide |
| SMILES | C=C/C=C(\C=C)SCC(N)CC(=O)N(C)C |
| InChI | InChI=1S/C12H20N2OS/c1-5-7-11(6-2)16-9-10(13)8-12(15)14(3)4/h5-7,10H,1-2,8-9,13H2,3-4H3/b11-7+ |
| InChIKey | XOGKHPAVFRBBRT-YRNVUSSQSA-N |
| XLogP | 1.78 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|