C28H31N7O4S — CID 142488276
4-[2-[4-[(2-ethoxyphenyl)diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]-1,3-thiazol-4-yl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 142488276) has the molecular formula C28H31N7O4S and a molecular weight of 561.67 g/mol. Its IUPAC name is 4-[2-[4-[(2-ethoxyphenyl)diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]-1,3-thiazol-4-yl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 4-[2-[4-[(2-ethoxyphenyl)diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]-1,3-thiazol-4-yl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 142488276 |
| Molecular Formula | C28H31N7O4S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 4-[2-[4-[(2-ethoxyphenyl)diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]-1,3-thiazol-4-yl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | CCOc1ccccc1/N=N/c1c(C)[nH]n(-c2nc(-c3ccc(C(=O)NCCN4CCOCC4)cc3)cs2)c1=O |
| InChI | InChI=1S/C28H31N7O4S/c1-3-39-24-7-5-4-6-22(24)31-32-25-19(2)33-35(27(25)37)28-30-23(18-40-28)20-8-10-21(11-9-20)26(36)29-12-13-34-14-16-38-17-15-34/h4-11,18,33H,3,12-17H2,1-2H3,(H,29,36)/b32-31+ |
| InChIKey | XSRODRHZNBJKMG-QNEJGDQOSA-N |
| XLogP | 4.47 |
| TPSA | 126.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|