C16H31N — CID 142489421
(2E,3Z)-2-butylidene-1-methyl-3-propylidenepyrrole;ethane (PubChem CID 142489421) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is (2E,3Z)-2-butylidene-1-methyl-3-propylidenepyrrole;ethane.
| Compound Name | (2E,3Z)-2-butylidene-1-methyl-3-propylidenepyrrole;ethane |
|---|---|
| PubChem CID | 142489421 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (2E,3Z)-2-butylidene-1-methyl-3-propylidenepyrrole;ethane |
| SMILES | CC.CC.CC/C=c1/ccn(C)/c1=C/CCC |
| InChI | InChI=1S/C12H19N.2C2H6/c1-4-6-8-12-11(7-5-2)9-10-13(12)3;2*1-2/h7-10H,4-6H2,1-3H3;2*1-2H3/b11-7-,12-8+;; |
| InChIKey | ZDXGPVHGIDCWPL-KMHHAUMDSA-N |
| XLogP | 3.85 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |