C17H20FN3O2S — CID 142490067
(1R,2R,3S,4R,5R)-5-fluoro-3-(2-methyl-4-pyridinyl)-N-(5-methyl-1,3-thiazol-2-yl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide;molecular hydrogen (PubChem CID 142490067) has the molecular formula C17H20FN3O2S and a molecular weight of 349.43 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R)-5-fluoro-3-(2-methyl-4-pyridinyl)-N-(5-methyl-1,3-thiazol-2-yl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide;molecular hydrogen.
| Compound Name | (1R,2R,3S,4R,5R)-5-fluoro-3-(2-methyl-4-pyridinyl)-N-(5-methyl-1,3-thiazol-2-yl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 142490067 |
| Molecular Formula | C17H20FN3O2S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (1R,2R,3S,4R,5R)-5-fluoro-3-(2-methyl-4-pyridinyl)-N-(5-methyl-1,3-thiazol-2-yl)-7-oxabicyclo[2.2.1]heptane-2-carboxamide;molecular hydrogen |
| SMILES | Cc1cc([C@H]2[C@H]3O[C@H](C[C@H]3F)[C@@H]2C(=O)Nc2ncc(C)s2)ccn1.[H][H] |
| InChI | InChI=1S/C17H18FN3O2S.H2/c1-8-5-10(3-4-19-8)13-14(12-6-11(18)15(13)23-12)16(22)21-17-20-7-9(2)24-17;/h3-5,7,11-15H,6H2,1-2H3,(H,20,21,22);1H/t11-,12-,13-,14+,15+;/m1./s1 |
| InChIKey | VGQHLXSOOLILIT-WRYQTTHSSA-N |
| XLogP | 3.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |