C22H25Cl2N5O2S — CID 142493572
1-(3,5-dichloro-2-pyridinyl)-3-[1-[4-[1-[(methylsulfanylamino)methyl]cyclopropyl]phenyl]-2-oxopiperidin-3-yl]urea (PubChem CID 142493572) has the molecular formula C22H25Cl2N5O2S and a molecular weight of 494.45 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)-3-[1-[4-[1-[(methylsulfanylamino)methyl]cyclopropyl]phenyl]-2-oxopiperidin-3-yl]urea.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)-3-[1-[4-[1-[(methylsulfanylamino)methyl]cyclopropyl]phenyl]-2-oxopiperidin-3-yl]urea |
|---|---|
| PubChem CID | 142493572 |
| Molecular Formula | C22H25Cl2N5O2S |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)-3-[1-[4-[1-[(methylsulfanylamino)methyl]cyclopropyl]phenyl]-2-oxopiperidin-3-yl]urea |
| SMILES | CSNCC1(c2ccc(N3CCCC(NC(=O)Nc4ncc(Cl)cc4Cl)C3=O)cc2)CC1 |
| InChI | InChI=1S/C22H25Cl2N5O2S/c1-32-26-13-22(8-9-22)14-4-6-16(7-5-14)29-10-2-3-18(20(29)30)27-21(31)28-19-17(24)11-15(23)12-25-19/h4-7,11-12,18,26H,2-3,8-10,13H2,1H3,(H2,25,27,28,31) |
| InChIKey | LRARJSBIDUCSRQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|