C23H26F3N5O2S — CID 142493575
1-[1-[4-[1-[(methylsulfanylamino)methyl]cyclopropyl]phenyl]-2-oxopiperidin-3-yl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea (PubChem CID 142493575) has the molecular formula C23H26F3N5O2S and a molecular weight of 493.56 g/mol. Its IUPAC name is 1-[1-[4-[1-[(methylsulfanylamino)methyl]cyclopropyl]phenyl]-2-oxopiperidin-3-yl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea.
| Compound Name | 1-[1-[4-[1-[(methylsulfanylamino)methyl]cyclopropyl]phenyl]-2-oxopiperidin-3-yl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 142493575 |
| Molecular Formula | C23H26F3N5O2S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 1-[1-[4-[1-[(methylsulfanylamino)methyl]cyclopropyl]phenyl]-2-oxopiperidin-3-yl]-3-[5-(trifluoromethyl)-2-pyridinyl]urea |
| SMILES | CSNCC1(c2ccc(N3CCCC(NC(=O)Nc4ccc(C(F)(F)F)cn4)C3=O)cc2)CC1 |
| InChI | InChI=1S/C23H26F3N5O2S/c1-34-28-14-22(10-11-22)15-4-7-17(8-5-15)31-12-2-3-18(20(31)32)29-21(33)30-19-9-6-16(13-27-19)23(24,25)26/h4-9,13,18,28H,2-3,10-12,14H2,1H3,(H2,27,29,30,33) |
| InChIKey | QZBHVOCHIQBUNL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|