C50H101NO5 — CID 142497662
9-[9-(2-hexyl-1-hydroxydecoxy)nonyl-(2-hydroxyethyl)amino]nonyl 2-butyldecanoate (PubChem CID 142497662) has the molecular formula C50H101NO5 and a molecular weight of 796.36 g/mol. Its IUPAC name is 9-[9-(2-hexyl-1-hydroxydecoxy)nonyl-(2-hydroxyethyl)amino]nonyl 2-butyldecanoate.
| Compound Name | 9-[9-(2-hexyl-1-hydroxydecoxy)nonyl-(2-hydroxyethyl)amino]nonyl 2-butyldecanoate |
|---|---|
| PubChem CID | 142497662 |
| Molecular Formula | C50H101NO5 |
| Molecular Weight | 796.36 g/mol |
| Exact Mass | 795.77 |
| IUPAC Name | 9-[9-(2-hexyl-1-hydroxydecoxy)nonyl-(2-hydroxyethyl)amino]nonyl 2-butyldecanoate |
| SMILES | CCCCCCCCC(CCCC)C(=O)OCCCCCCCCCN(CCO)CCCCCCCCCOC(O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C50H101NO5/c1-5-9-13-16-24-31-39-47(37-12-8-4)49(53)55-45-35-28-22-18-20-26-33-41-51(43-44-52)42-34-27-21-19-23-29-36-46-56-50(54)48(38-30-15-11-7-3)40-32-25-17-14-10-6-2/h47-48,50,52,54H,5-46H2,1-4H3 |
| InChIKey | RNIWLFIABBUGKJ-UHFFFAOYSA-N |
| XLogP | 14.51 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.36 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|