C12H15NO6 — CID 142501007
6,7-dihydroxy-1-methyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;formic acid (PubChem CID 142501007) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is 6,7-dihydroxy-1-methyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;formic acid.
| Compound Name | 6,7-dihydroxy-1-methyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 142501007 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 6,7-dihydroxy-1-methyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;formic acid |
| SMILES | CC1NC(C(=O)O)Cc2cc(O)c(O)cc21.O=CO |
| InChI | InChI=1S/C11H13NO4.CH2O2/c1-5-7-4-10(14)9(13)3-6(7)2-8(12-5)11(15)16;2-1-3/h3-5,8,12-14H,2H2,1H3,(H,15,16);1H,(H,2,3) |
| InChIKey | VCUAXCZZLPGQOM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|