C21H30N2O3 — CID 142505547
N-cyclohexyl-5,6,7-trimethoxy-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 142505547) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is N-cyclohexyl-5,6,7-trimethoxy-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-cyclohexyl-5,6,7-trimethoxy-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 142505547 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N-cyclohexyl-5,6,7-trimethoxy-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | COc1cc2[nH]c3c(c2c(OC)c1OC)CCCC3NC1CCCCC1 |
| InChI | InChI=1S/C21H30N2O3/c1-24-17-12-16-18(21(26-3)20(17)25-2)14-10-7-11-15(19(14)23-16)22-13-8-5-4-6-9-13/h12-13,15,22-23H,4-11H2,1-3H3 |
| InChIKey | MZEZJHXSVREMMD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |