C15H20F2N2O — CID 142508471
4-[[(Z)-3-anilinobut-1-enyl]amino]-2,2-difluoropentan-3-one (PubChem CID 142508471) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is 4-[[(Z)-3-anilinobut-1-enyl]amino]-2,2-difluoropentan-3-one.
| Compound Name | 4-[[(Z)-3-anilinobut-1-enyl]amino]-2,2-difluoropentan-3-one |
|---|---|
| PubChem CID | 142508471 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-[[(Z)-3-anilinobut-1-enyl]amino]-2,2-difluoropentan-3-one |
| SMILES | CC(/C=C\NC(C)C(=O)C(C)(F)F)Nc1ccccc1 |
| InChI | InChI=1S/C15H20F2N2O/c1-11(19-13-7-5-4-6-8-13)9-10-18-12(2)14(20)15(3,16)17/h4-12,18-19H,1-3H3/b10-9- |
| InChIKey | HIGMEEGLZZHPTO-KTKRTIGZSA-N |
| XLogP | 3.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |