C23H28N4 — CID 142511112
(2E)-N,3,4-trimethyl-1-[7-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]penta-2,4-dien-1-imine (PubChem CID 142511112) has the molecular formula C23H28N4 and a molecular weight of 360.51 g/mol. Its IUPAC name is (2E)-N,3,4-trimethyl-1-[7-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]penta-2,4-dien-1-imine.
| Compound Name | (2E)-N,3,4-trimethyl-1-[7-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142511112 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2E)-N,3,4-trimethyl-1-[7-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]penta-2,4-dien-1-imine |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C1=CC(=C)N2C=C(C3=CCN(C)CC3)C=CC2=N1 |
| InChI | InChI=1S/C23H28N4/c1-16(2)17(3)13-21(24-5)22-14-18(4)27-15-20(7-8-23(27)25-22)19-9-11-26(6)12-10-19/h7-9,13-15H,1,4,10-12H2,2-3,5-6H3/b17-13+,24-21+ |
| InChIKey | LFNHYPQEZYIODP-XADPGMCUSA-N |
| XLogP | 4.41 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|