C19H20BN3O8 — CID 142513916
3-(2-boronoethyl)-2-hydroxy-6-[1-(3-nitrobenzenecarboximidoyl)azetidin-3-yl]oxybenzoic acid (PubChem CID 142513916) has the molecular formula C19H20BN3O8 and a molecular weight of 429.19 g/mol. Its IUPAC name is 3-(2-boronoethyl)-2-hydroxy-6-[1-(3-nitrobenzenecarboximidoyl)azetidin-3-yl]oxybenzoic acid.
| Compound Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-(3-nitrobenzenecarboximidoyl)azetidin-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 142513916 |
| Molecular Formula | C19H20BN3O8 |
| Molecular Weight | 429.19 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-(3-nitrobenzenecarboximidoyl)azetidin-3-yl]oxybenzoic acid |
| SMILES | [H]/N=C(\c1cccc([N+](=O)[O-])c1)N1CC(Oc2ccc(CCB(O)O)c(O)c2C(=O)O)C1 |
| InChI | InChI=1S/C19H20BN3O8/c21-18(12-2-1-3-13(8-12)23(29)30)22-9-14(10-22)31-15-5-4-11(6-7-20(27)28)17(24)16(15)19(25)26/h1-5,8,14,21,24,27-28H,6-7,9-10H2,(H,25,26)/b21-18+ |
| InChIKey | DKZJLGXECKGBKE-DYTRJAOYSA-N |
| XLogP | 1.10 |
| TPSA | 177.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|