C17H19BN2O8S — CID 152549194
3-(2-boronoethyl)-2-hydroxy-6-(1-pyridin-3-ylsulfonylazetidin-3-yl)oxybenzoic acid (PubChem CID 152549194) has the molecular formula C17H19BN2O8S and a molecular weight of 422.22 g/mol. Its IUPAC name is 3-(2-boronoethyl)-2-hydroxy-6-(1-pyridin-3-ylsulfonylazetidin-3-yl)oxybenzoic acid.
| Compound Name | 3-(2-boronoethyl)-2-hydroxy-6-(1-pyridin-3-ylsulfonylazetidin-3-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 152549194 |
| Molecular Formula | C17H19BN2O8S |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-(2-boronoethyl)-2-hydroxy-6-(1-pyridin-3-ylsulfonylazetidin-3-yl)oxybenzoic acid |
| SMILES | O=C(O)c1c(OC2CN(S(=O)(=O)c3cccnc3)C2)ccc(CCB(O)O)c1O |
| InChI | InChI=1S/C17H19BN2O8S/c21-16-11(5-6-18(24)25)3-4-14(15(16)17(22)23)28-12-9-20(10-12)29(26,27)13-2-1-7-19-8-13/h1-4,7-8,12,21,24-25H,5-6,9-10H2,(H,22,23) |
| InChIKey | YNCXOZLNIAUZRR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 157.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|