C18H19BN2O7 — CID 147166354
3-(2-boronoethyl)-2-hydroxy-6-[1-(pyridine-3-carbonyl)azetidin-3-yl]oxybenzoic acid (PubChem CID 147166354) has the molecular formula C18H19BN2O7 and a molecular weight of 386.17 g/mol. Its IUPAC name is 3-(2-boronoethyl)-2-hydroxy-6-[1-(pyridine-3-carbonyl)azetidin-3-yl]oxybenzoic acid.
| Compound Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-(pyridine-3-carbonyl)azetidin-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 147166354 |
| Molecular Formula | C18H19BN2O7 |
| Molecular Weight | 386.17 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-(pyridine-3-carbonyl)azetidin-3-yl]oxybenzoic acid |
| SMILES | O=C(O)c1c(OC2CN(C(=O)c3cccnc3)C2)ccc(CCB(O)O)c1O |
| InChI | InChI=1S/C18H19BN2O7/c22-16-11(5-6-19(26)27)3-4-14(15(16)18(24)25)28-13-9-21(10-13)17(23)12-2-1-7-20-8-12/h1-4,7-8,13,22,26-27H,5-6,9-10H2,(H,24,25) |
| InChIKey | BWVSILHCNHOAFY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|