C16H18BN3O7S — CID 150980184
6-[1-(2-amino-1,3-thiazole-4-carbonyl)azetidin-3-yl]oxy-3-(2-boronoethyl)-2-hydroxybenzoic acid (PubChem CID 150980184) has the molecular formula C16H18BN3O7S and a molecular weight of 407.21 g/mol. Its IUPAC name is 6-[1-(2-amino-1,3-thiazole-4-carbonyl)azetidin-3-yl]oxy-3-(2-boronoethyl)-2-hydroxybenzoic acid.
| Compound Name | 6-[1-(2-amino-1,3-thiazole-4-carbonyl)azetidin-3-yl]oxy-3-(2-boronoethyl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 150980184 |
| Molecular Formula | C16H18BN3O7S |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 6-[1-(2-amino-1,3-thiazole-4-carbonyl)azetidin-3-yl]oxy-3-(2-boronoethyl)-2-hydroxybenzoic acid |
| SMILES | Nc1nc(C(=O)N2CC(Oc3ccc(CCB(O)O)c(O)c3C(=O)O)C2)cs1 |
| InChI | InChI=1S/C16H18BN3O7S/c18-16-19-10(7-28-16)14(22)20-5-9(6-20)27-11-2-1-8(3-4-17(25)26)13(21)12(11)15(23)24/h1-2,7,9,21,25-26H,3-6H2,(H2,18,19)(H,23,24) |
| InChIKey | LPXWQJVRAPHPAX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|