C18H24BN5O7 — CID 151709852
3-(2-boronoethyl)-2-hydroxy-6-[1-[2-[4-(methylaminomethyl)triazol-1-yl]acetyl]azetidin-3-yl]oxybenzoic acid (PubChem CID 151709852) has the molecular formula C18H24BN5O7 and a molecular weight of 433.23 g/mol. Its IUPAC name is 3-(2-boronoethyl)-2-hydroxy-6-[1-[2-[4-(methylaminomethyl)triazol-1-yl]acetyl]azetidin-3-yl]oxybenzoic acid.
| Compound Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-[2-[4-(methylaminomethyl)triazol-1-yl]acetyl]azetidin-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 151709852 |
| Molecular Formula | C18H24BN5O7 |
| Molecular Weight | 433.23 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-[2-[4-(methylaminomethyl)triazol-1-yl]acetyl]azetidin-3-yl]oxybenzoic acid |
| SMILES | CNCc1cn(CC(=O)N2CC(Oc3ccc(CCB(O)O)c(O)c3C(=O)O)C2)nn1 |
| InChI | InChI=1S/C18H24BN5O7/c1-20-6-12-7-24(22-21-12)10-15(25)23-8-13(9-23)31-14-3-2-11(4-5-19(29)30)17(26)16(14)18(27)28/h2-3,7,13,20,26,29-30H,4-6,8-10H2,1H3,(H,27,28) |
| InChIKey | RGIDEECOJRDEJH-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 170.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.23 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|