C18H25BN2O8 — CID 159210416
6-[1-[(2R)-2-amino-4-oxohexanoyl]azetidin-3-yl]oxy-3-(2-boronoethyl)-2-hydroxybenzoic acid (PubChem CID 159210416) has the molecular formula C18H25BN2O8 and a molecular weight of 408.22 g/mol. Its IUPAC name is 6-[1-[(2R)-2-amino-4-oxohexanoyl]azetidin-3-yl]oxy-3-(2-boronoethyl)-2-hydroxybenzoic acid.
| Compound Name | 6-[1-[(2R)-2-amino-4-oxohexanoyl]azetidin-3-yl]oxy-3-(2-boronoethyl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 159210416 |
| Molecular Formula | C18H25BN2O8 |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 6-[1-[(2R)-2-amino-4-oxohexanoyl]azetidin-3-yl]oxy-3-(2-boronoethyl)-2-hydroxybenzoic acid |
| SMILES | CCC(=O)C[C@@H](N)C(=O)N1CC(Oc2ccc(CCB(O)O)c(O)c2C(=O)O)C1 |
| InChI | InChI=1S/C18H25BN2O8/c1-2-11(22)7-13(20)17(24)21-8-12(9-21)29-14-4-3-10(5-6-19(27)28)16(23)15(14)18(25)26/h3-4,12-13,23,27-28H,2,5-9,20H2,1H3,(H,25,26)/t13-/m1/s1 |
| InChIKey | KQKPYQKCHWCJBW-CYBMUJFWSA-N |
| XLogP | -0.61 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|