C18H21BN2O7S — CID 142514014
3-(2-boronoethyl)-2-hydroxy-6-[1-[N-hydroxy-C-(thiophen-2-ylmethyl)carbonimidoyl]azetidin-3-yl]oxybenzoic acid (PubChem CID 142514014) has the molecular formula C18H21BN2O7S and a molecular weight of 420.25 g/mol. Its IUPAC name is 3-(2-boronoethyl)-2-hydroxy-6-[1-[N-hydroxy-C-(thiophen-2-ylmethyl)carbonimidoyl]azetidin-3-yl]oxybenzoic acid.
| Compound Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-[N-hydroxy-C-(thiophen-2-ylmethyl)carbonimidoyl]azetidin-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 142514014 |
| Molecular Formula | C18H21BN2O7S |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-[N-hydroxy-C-(thiophen-2-ylmethyl)carbonimidoyl]azetidin-3-yl]oxybenzoic acid |
| SMILES | O=C(O)c1c(OC2CN(C(Cc3cccs3)=NO)C2)ccc(CCB(O)O)c1O |
| InChI | InChI=1S/C18H21BN2O7S/c22-17-11(5-6-19(25)26)3-4-14(16(17)18(23)24)28-12-9-21(10-12)15(20-27)8-13-2-1-7-29-13/h1-4,7,12,22,25-27H,5-6,8-10H2,(H,23,24) |
| InChIKey | HCPWTHDVBQCXMD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 143.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|