C18H26BFN2O7 — CID 174089096
2-[3-(dihydroxymethyl)-4-[1-[2-[(2R,4S)-4-fluoropyrrolidin-2-yl]acetyl]azetidin-3-yl]oxy-2-hydroxyphenyl]ethylboronic acid (PubChem CID 174089096) has the molecular formula C18H26BFN2O7 and a molecular weight of 412.22 g/mol. Its IUPAC name is 2-[3-(dihydroxymethyl)-4-[1-[2-[(2R,4S)-4-fluoropyrrolidin-2-yl]acetyl]azetidin-3-yl]oxy-2-hydroxyphenyl]ethylboronic acid.
| Compound Name | 2-[3-(dihydroxymethyl)-4-[1-[2-[(2R,4S)-4-fluoropyrrolidin-2-yl]acetyl]azetidin-3-yl]oxy-2-hydroxyphenyl]ethylboronic acid |
|---|---|
| PubChem CID | 174089096 |
| Molecular Formula | C18H26BFN2O7 |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-[3-(dihydroxymethyl)-4-[1-[2-[(2R,4S)-4-fluoropyrrolidin-2-yl]acetyl]azetidin-3-yl]oxy-2-hydroxyphenyl]ethylboronic acid |
| SMILES | O=C(C[C@@H]1C[C@H](F)CN1)N1CC(Oc2ccc(CCB(O)O)c(O)c2C(O)O)C1 |
| InChI | InChI=1S/C18H26BFN2O7/c20-11-5-12(21-7-11)6-15(23)22-8-13(9-22)29-14-2-1-10(3-4-19(27)28)17(24)16(14)18(25)26/h1-2,11-13,18,21,24-28H,3-9H2/t11-,12-/m0/s1 |
| InChIKey | RRSRMGGJMYQMGS-RYUDHWBXSA-N |
| XLogP | -0.93 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|