C18H25BN2O7 — CID 152568012
3-(2-boronoethyl)-2-hydroxy-6-[1-(piperidine-4-carbonyl)azetidin-3-yl]oxybenzoic acid (PubChem CID 152568012) has the molecular formula C18H25BN2O7 and a molecular weight of 392.22 g/mol. Its IUPAC name is 3-(2-boronoethyl)-2-hydroxy-6-[1-(piperidine-4-carbonyl)azetidin-3-yl]oxybenzoic acid.
| Compound Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-(piperidine-4-carbonyl)azetidin-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 152568012 |
| Molecular Formula | C18H25BN2O7 |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-(piperidine-4-carbonyl)azetidin-3-yl]oxybenzoic acid |
| SMILES | O=C(O)c1c(OC2CN(C(=O)C3CCNCC3)C2)ccc(CCB(O)O)c1O |
| InChI | InChI=1S/C18H25BN2O7/c22-16-11(3-6-19(26)27)1-2-14(15(16)18(24)25)28-13-9-21(10-13)17(23)12-4-7-20-8-5-12/h1-2,12-13,20,22,26-27H,3-10H2,(H,24,25) |
| InChIKey | YQWUBRUGRAEOBT-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|