C17H19BN4O6 — CID 142513970
3-(2-boronoethyl)-2-hydroxy-6-[1-(pyridazine-3-carboximidoyl)azetidin-3-yl]oxybenzoic acid (PubChem CID 142513970) has the molecular formula C17H19BN4O6 and a molecular weight of 386.17 g/mol. Its IUPAC name is 3-(2-boronoethyl)-2-hydroxy-6-[1-(pyridazine-3-carboximidoyl)azetidin-3-yl]oxybenzoic acid.
| Compound Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-(pyridazine-3-carboximidoyl)azetidin-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 142513970 |
| Molecular Formula | C17H19BN4O6 |
| Molecular Weight | 386.17 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 3-(2-boronoethyl)-2-hydroxy-6-[1-(pyridazine-3-carboximidoyl)azetidin-3-yl]oxybenzoic acid |
| SMILES | [H]/N=C(\c1cccnn1)N1CC(Oc2ccc(CCB(O)O)c(O)c2C(=O)O)C1 |
| InChI | InChI=1S/C17H19BN4O6/c19-16(12-2-1-7-20-21-12)22-8-11(9-22)28-13-4-3-10(5-6-18(26)27)15(23)14(13)17(24)25/h1-4,7,11,19,23,26-27H,5-6,8-9H2,(H,24,25)/b19-16+ |
| InChIKey | LVCOOFBLFANFKJ-KNTRCKAVSA-N |
| XLogP | -0.02 |
| TPSA | 160.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.17 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|