C27H26F2N8O — CID 142514679
7-(2,6-difluorophenyl)-12-[3,5-dimethyl-4-(4-methylpiperazin-1-yl)anilino]-3,6,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaen-8-one (PubChem CID 142514679) has the molecular formula C27H26F2N8O and a molecular weight of 516.56 g/mol. Its IUPAC name is 7-(2,6-difluorophenyl)-12-[3,5-dimethyl-4-(4-methylpiperazin-1-yl)anilino]-3,6,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaen-8-one.
| Compound Name | 7-(2,6-difluorophenyl)-12-[3,5-dimethyl-4-(4-methylpiperazin-1-yl)anilino]-3,6,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaen-8-one |
|---|---|
| PubChem CID | 142514679 |
| Molecular Formula | C27H26F2N8O |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 7-(2,6-difluorophenyl)-12-[3,5-dimethyl-4-(4-methylpiperazin-1-yl)anilino]-3,6,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaen-8-one |
| SMILES | Cc1cc(Nc2ncc3c(=O)n(-c4c(F)cccc4F)n4ccnc4c3n2)cc(C)c1N1CCN(C)CC1 |
| InChI | InChI=1S/C27H26F2N8O/c1-16-13-18(14-17(2)23(16)35-11-9-34(3)10-12-35)32-27-31-15-19-22(33-27)25-30-7-8-36(25)37(26(19)38)24-20(28)5-4-6-21(24)29/h4-8,13-15H,9-12H2,1-3H3,(H,31,32,33) |
| InChIKey | DRBTVCQKOWKRDR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|