C11H10N5O5+ — CID 142517312
[3-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-4-nitrophenyl]imino-iminoazanium (PubChem CID 142517312) has the molecular formula C11H10N5O5+ and a molecular weight of 292.23 g/mol. Its IUPAC name is [3-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-4-nitrophenyl]imino-iminoazanium.
| Compound Name | [3-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-4-nitrophenyl]imino-iminoazanium |
|---|---|
| PubChem CID | 142517312 |
| Molecular Formula | C11H10N5O5+ |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | [3-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-4-nitrophenyl]imino-iminoazanium |
| SMILES | N=[N+]=Nc1ccc([N+](=O)[O-])c(CON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C11H10N5O5/c12-14-13-8-1-2-9(16(19)20)7(5-8)6-21-15-10(17)3-4-11(15)18/h1-2,5,12H,3-4,6H2/q+1 |
| InChIKey | LTXCIQLTLPUDMQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|