C12H11N4O5+ — CID 152899796
[3-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-4-nitrophenyl]imino-methylideneazanium (PubChem CID 152899796) has the molecular formula C12H11N4O5+ and a molecular weight of 291.24 g/mol. Its IUPAC name is [3-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-4-nitrophenyl]imino-methylideneazanium.
| Compound Name | [3-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-4-nitrophenyl]imino-methylideneazanium |
|---|---|
| PubChem CID | 152899796 |
| Molecular Formula | C12H11N4O5+ |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | [3-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-4-nitrophenyl]imino-methylideneazanium |
| SMILES | C=[N+]=Nc1ccc([N+](=O)[O-])c(CON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C12H11N4O5/c1-13-14-9-2-3-10(16(19)20)8(6-9)7-21-15-11(17)4-5-12(15)18/h2-3,6H,1,4-5,7H2/q+1 |
| InChIKey | QDPOFBVKEFLQNI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 116.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|