C18H39N — CID 142526042
4-methylnonane;N,4,4-trimethylpent-1-en-2-amine (PubChem CID 142526042) has the molecular formula C18H39N and a molecular weight of 269.52 g/mol. Its IUPAC name is 4-methylnonane;N,4,4-trimethylpent-1-en-2-amine.
| Compound Name | 4-methylnonane;N,4,4-trimethylpent-1-en-2-amine |
|---|---|
| PubChem CID | 142526042 |
| Molecular Formula | C18H39N |
| Molecular Weight | 269.52 g/mol |
| Exact Mass | 269.31 |
| IUPAC Name | 4-methylnonane;N,4,4-trimethylpent-1-en-2-amine |
| SMILES | C=C(CC(C)(C)C)NC.CCCCCC(C)CCC |
| InChI | InChI=1S/C10H22.C8H17N/c1-4-6-7-9-10(3)8-5-2;1-7(9-5)6-8(2,3)4/h10H,4-9H2,1-3H3;9H,1,6H2,2-5H3 |
| InChIKey | CSXMUUPANFEHLJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|