C20H35N5O3S — CID 142529504
(E)-3-(dimethylamino)-2-(methylamino)-1-(methylideneamino)prop-1-ene-1-sulfinic acid;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea;molecular hydrogen (PubChem CID 142529504) has the molecular formula C20H35N5O3S and a molecular weight of 425.60 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-2-(methylamino)-1-(methylideneamino)prop-1-ene-1-sulfinic acid;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea;molecular hydrogen.
| Compound Name | (E)-3-(dimethylamino)-2-(methylamino)-1-(methylideneamino)prop-1-ene-1-sulfinic acid;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea;molecular hydrogen |
|---|---|
| PubChem CID | 142529504 |
| Molecular Formula | C20H35N5O3S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (E)-3-(dimethylamino)-2-(methylamino)-1-(methylideneamino)prop-1-ene-1-sulfinic acid;1,2,3,5,6,7-hexahydro-s-indacen-4-ylurea;molecular hydrogen |
| SMILES | C=N/C(=C(/CN(C)C)NC)S(=O)O.NC(=O)Nc1c2c(cc3c1CCC3)CCC2.[H][H].[H][H] |
| InChI | InChI=1S/C13H16N2O.C7H15N3O2S.2H2/c14-13(16)15-12-10-5-1-3-8(10)7-9-4-2-6-11(9)12;1-8-6(5-10(3)4)7(9-2)13(11)12;;/h7H,1-6H2,(H3,14,15,16);8H,2,5H2,1,3-4H3,(H,11,12);2*1H/b;7-6+;; |
| InChIKey | BNNSIFJOVDKXHO-MEAFHCEDSA-N |
| XLogP | 2.51 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|