C15H23N3O4 — CID 142535899
molecular hydrogen;5-oxo-4-[[2-(2-oxo-1,3-dihydroindol-5-yl)acetyl]amino]pentanamide (PubChem CID 142535899) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is molecular hydrogen;5-oxo-4-[[2-(2-oxo-1,3-dihydroindol-5-yl)acetyl]amino]pentanamide.
| Compound Name | molecular hydrogen;5-oxo-4-[[2-(2-oxo-1,3-dihydroindol-5-yl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 142535899 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | molecular hydrogen;5-oxo-4-[[2-(2-oxo-1,3-dihydroindol-5-yl)acetyl]amino]pentanamide |
| SMILES | NC(=O)CCC(C=O)NC(=O)Cc1ccc2c(c1)CC(=O)N2.[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C15H17N3O4.3H2/c16-13(20)4-2-11(8-19)17-14(21)6-9-1-3-12-10(5-9)7-15(22)18-12;;;/h1,3,5,8,11H,2,4,6-7H2,(H2,16,20)(H,17,21)(H,18,22);3*1H |
| InChIKey | RZTURGMZZZDKHX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|