C14H15ClO2S — CID 142536310
2-[5-(3-chlorophenyl)thiophen-2-yl]acetic acid;ethane (PubChem CID 142536310) has the molecular formula C14H15ClO2S and a molecular weight of 282.79 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)thiophen-2-yl]acetic acid;ethane.
| Compound Name | 2-[5-(3-chlorophenyl)thiophen-2-yl]acetic acid;ethane |
|---|---|
| PubChem CID | 142536310 |
| Molecular Formula | C14H15ClO2S |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-[5-(3-chlorophenyl)thiophen-2-yl]acetic acid;ethane |
| SMILES | CC.O=C(O)Cc1ccc(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C12H9ClO2S.C2H6/c13-9-3-1-2-8(6-9)11-5-4-10(16-11)7-12(14)15;1-2/h1-6H,7H2,(H,14,15);1-2H3 |
| InChIKey | VCAMJCFQIMGESW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |