C13H23N — CID 142546554
(3Z,5Z,7E)-4-butan-2-ylnona-3,5,7-trien-3-amine (PubChem CID 142546554) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (3Z,5Z,7E)-4-butan-2-ylnona-3,5,7-trien-3-amine.
| Compound Name | (3Z,5Z,7E)-4-butan-2-ylnona-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 142546554 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (3Z,5Z,7E)-4-butan-2-ylnona-3,5,7-trien-3-amine |
| SMILES | C/C=C/C=C\C(=C(/N)CC)C(C)CC |
| InChI | InChI=1S/C13H23N/c1-5-8-9-10-12(11(4)6-2)13(14)7-3/h5,8-11H,6-7,14H2,1-4H3/b8-5+,10-9-,13-12+ |
| InChIKey | IUOSJAJLOKEEGX-ZOZVOWEUSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|