C23H36O5 — CID 142558042
[(7R,10R,12R)-10-ethyl-11-hydroxy-6,8,10,12-tetramethyl-4-oxo-7-tetracyclo[6.4.3.01,5.06,15]pentadecanyl] 2-hydroxyacetate (PubChem CID 142558042) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is [(7R,10R,12R)-10-ethyl-11-hydroxy-6,8,10,12-tetramethyl-4-oxo-7-tetracyclo[6.4.3.01,5.06,15]pentadecanyl] 2-hydroxyacetate.
| Compound Name | [(7R,10R,12R)-10-ethyl-11-hydroxy-6,8,10,12-tetramethyl-4-oxo-7-tetracyclo[6.4.3.01,5.06,15]pentadecanyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 142558042 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | [(7R,10R,12R)-10-ethyl-11-hydroxy-6,8,10,12-tetramethyl-4-oxo-7-tetracyclo[6.4.3.01,5.06,15]pentadecanyl] 2-hydroxyacetate |
| SMILES | CC[C@]1(C)CC2(C)C3CCC4(CCC(=O)C4C3(C)[C@@H]2OC(=O)CO)[C@@H](C)C1O |
| InChI | InChI=1S/C23H36O5/c1-6-20(3)12-21(4)15-8-10-23(13(2)18(20)27)9-7-14(25)17(23)22(15,5)19(21)28-16(26)11-24/h13,15,17-19,24,27H,6-12H2,1-5H3/t13-,15?,17?,18?,19+,20+,21?,22?,23?/m0/s1 |
| InChIKey | KXXLVZYMFNPAMY-WHDBQJMTSA-N |
| XLogP | 3.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |