C13H24FN — CID 142558436
6-fluoro-6-methyl-N-pent-4-en-2-ylhept-1-en-2-amine (PubChem CID 142558436) has the molecular formula C13H24FN and a molecular weight of 213.34 g/mol. Its IUPAC name is 6-fluoro-6-methyl-N-pent-4-en-2-ylhept-1-en-2-amine.
| Compound Name | 6-fluoro-6-methyl-N-pent-4-en-2-ylhept-1-en-2-amine |
|---|---|
| PubChem CID | 142558436 |
| Molecular Formula | C13H24FN |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | 6-fluoro-6-methyl-N-pent-4-en-2-ylhept-1-en-2-amine |
| SMILES | C=CCC(C)NC(=C)CCCC(C)(C)F |
| InChI | InChI=1S/C13H24FN/c1-6-8-11(2)15-12(3)9-7-10-13(4,5)14/h6,11,15H,1,3,7-10H2,2,4-5H3 |
| InChIKey | RSBUHAJMPFWMFF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|