C11H12BrN — CID 142562392
N-[1-(3-bromocyclohexa-1,3-dien-1-yl)ethenyl]prop-2-en-1-imine (PubChem CID 142562392) has the molecular formula C11H12BrN and a molecular weight of 238.13 g/mol. Its IUPAC name is N-[1-(3-bromocyclohexa-1,3-dien-1-yl)ethenyl]prop-2-en-1-imine.
| Compound Name | N-[1-(3-bromocyclohexa-1,3-dien-1-yl)ethenyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 142562392 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | N-[1-(3-bromocyclohexa-1,3-dien-1-yl)ethenyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C(=C)C1=CC(Br)=CCC1 |
| InChI | InChI=1S/C11H12BrN/c1-3-7-13-9(2)10-5-4-6-11(12)8-10/h3,6-8H,1-2,4-5H2/b13-7+ |
| InChIKey | DREJKOCWSCKONN-NTUHNPAUSA-N |
| XLogP | 3.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|