C12H16N2 — CID 145365892
5-buta-1,3-dien-2-yl-N'-methylcyclohexa-1,5-diene-1-carboximidamide (PubChem CID 145365892) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 5-buta-1,3-dien-2-yl-N'-methylcyclohexa-1,5-diene-1-carboximidamide.
| Compound Name | 5-buta-1,3-dien-2-yl-N'-methylcyclohexa-1,5-diene-1-carboximidamide |
|---|---|
| PubChem CID | 145365892 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 5-buta-1,3-dien-2-yl-N'-methylcyclohexa-1,5-diene-1-carboximidamide |
| SMILES | C=CC(=C)C1=CC(/C(N)=N/C)=CCC1 |
| InChI | InChI=1S/C12H16N2/c1-4-9(2)10-6-5-7-11(8-10)12(13)14-3/h4,7-8H,1-2,5-6H2,3H3,(H2,13,14) |
| InChIKey | CNTVTADPKHSDFT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|