C20H27N5O5 — CID 142565117
tert-butyl (3R)-3-[(11-ethyl-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-5-yl)methyl]morpholine-4-carboxylate (PubChem CID 142565117) has the molecular formula C20H27N5O5 and a molecular weight of 417.47 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(11-ethyl-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-5-yl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(11-ethyl-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-5-yl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 142565117 |
| Molecular Formula | C20H27N5O5 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | tert-butyl (3R)-3-[(11-ethyl-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-5-yl)methyl]morpholine-4-carboxylate |
| SMILES | CCc1cc2nc3c(c(=O)n2[nH]1)CN(C[C@@H]1COCCN1C(=O)OC(C)(C)C)C3=O |
| InChI | InChI=1S/C20H27N5O5/c1-5-12-8-15-21-16-14(17(26)25(15)22-12)10-23(18(16)27)9-13-11-29-7-6-24(13)19(28)30-20(2,3)4/h8,13,22H,5-7,9-11H2,1-4H3/t13-/m1/s1 |
| InChIKey | QRCLIZSRQSUSHS-CYBMUJFWSA-N |
| XLogP | 1.18 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |