C26H33N5S — CID 142573443
8-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2-phenyl-2,8-diazaspiro[4.5]decane (PubChem CID 142573443) has the molecular formula C26H33N5S and a molecular weight of 447.65 g/mol. Its IUPAC name is 8-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2-phenyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2-phenyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 142573443 |
| Molecular Formula | C26H33N5S |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 8-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]-2-phenyl-2,8-diazaspiro[4.5]decane |
| SMILES | Cn1c(SCCCN2CCC3(CC2)CCN(c2ccccc2)C3)nnc1-c1ccccc1 |
| InChI | InChI=1S/C26H33N5S/c1-29-24(22-9-4-2-5-10-22)27-28-25(29)32-20-8-16-30-17-13-26(14-18-30)15-19-31(21-26)23-11-6-3-7-12-23/h2-7,9-12H,8,13-21H2,1H3 |
| InChIKey | ZMKMMKGIOMTNLP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|