C18H10O8 — CID 142574667
4-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-methoxycarbonylbenzoic acid (PubChem CID 142574667) has the molecular formula C18H10O8 and a molecular weight of 354.27 g/mol. Its IUPAC name is 4-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-methoxycarbonylbenzoic acid.
| Compound Name | 4-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-methoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 142574667 |
| Molecular Formula | C18H10O8 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-methoxycarbonylbenzoic acid |
| SMILES | COC(=O)c1cc(C(=O)c2ccc3c(c2)C(=O)OC3=O)ccc1C(=O)O |
| InChI | InChI=1S/C18H10O8/c1-25-16(22)12-6-8(2-4-10(12)15(20)21)14(19)9-3-5-11-13(7-9)18(24)26-17(11)23/h2-7H,1H3,(H,20,21) |
| InChIKey | VUPRNYWMVNCTBS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|