C15H9F6NO — CID 142577532
4-[(2R)-oxiran-2-yl]-2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]pyridine (PubChem CID 142577532) has the molecular formula C15H9F6NO and a molecular weight of 333.23 g/mol. Its IUPAC name is 4-[(2R)-oxiran-2-yl]-2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 4-[(2R)-oxiran-2-yl]-2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 142577532 |
| Molecular Formula | C15H9F6NO |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-[(2R)-oxiran-2-yl]-2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]pyridine |
| SMILES | FC(F)(F)c1ccc(-c2cc([C@@H]3CO3)cc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H9F6NO/c16-14(17,18)10-3-1-8(2-4-10)11-5-9(12-7-23-12)6-13(22-11)15(19,20)21/h1-6,12H,7H2/t12-/m0/s1 |
| InChIKey | SADMVESFOIYNNA-LBPRGKRZSA-N |
| XLogP | 4.86 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|