C18H26N2O3 — CID 142578377
N-(1-formamido-2-hydroxy-3,3,5,5-tetramethylcyclohexyl)benzamide (PubChem CID 142578377) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(1-formamido-2-hydroxy-3,3,5,5-tetramethylcyclohexyl)benzamide.
| Compound Name | N-(1-formamido-2-hydroxy-3,3,5,5-tetramethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 142578377 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-(1-formamido-2-hydroxy-3,3,5,5-tetramethylcyclohexyl)benzamide |
| SMILES | CC1(C)CC(C)(C)C(O)C(NC=O)(NC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-16(2)10-17(3,4)15(23)18(11-16,19-12-21)20-14(22)13-8-6-5-7-9-13/h5-9,12,15,23H,10-11H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | NNUCOSOWYMYOKT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|