C11H15N3O5 — CID 142579206
(2S)-5-amino-2-[2-(3,5-dihydroxyphenyl)hydrazinyl]-5-oxopentanoic acid (PubChem CID 142579206) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is (2S)-5-amino-2-[2-(3,5-dihydroxyphenyl)hydrazinyl]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[2-(3,5-dihydroxyphenyl)hydrazinyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 142579206 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (2S)-5-amino-2-[2-(3,5-dihydroxyphenyl)hydrazinyl]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NNc1cc(O)cc(O)c1)C(=O)O |
| InChI | InChI=1S/C11H15N3O5/c12-10(17)2-1-9(11(18)19)14-13-6-3-7(15)5-8(16)4-6/h3-5,9,13-16H,1-2H2,(H2,12,17)(H,18,19)/t9-/m0/s1 |
| InChIKey | GDGBIUVPUVAJDN-VIFPVBQESA-N |
| XLogP | -0.27 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|