C12H12N2O — CID 142580649
6,7-bis(ethenyl)-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 142580649) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 6,7-bis(ethenyl)-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 6,7-bis(ethenyl)-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 142580649 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 6,7-bis(ethenyl)-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | C=Cc1cc2c(cc1C=C)NC(=O)CN2 |
| InChI | InChI=1S/C12H12N2O/c1-3-8-5-10-11(6-9(8)4-2)14-12(15)7-13-10/h3-6,13H,1-2,7H2,(H,14,15) |
| InChIKey | HHSFHTVKAKRDGF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |