C15H31N — CID 142581839
N,N-dimethyl-2-[1-methyl-3-(2-methylpropylidene)cyclobutyl]ethanamine;ethane (PubChem CID 142581839) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[1-methyl-3-(2-methylpropylidene)cyclobutyl]ethanamine;ethane.
| Compound Name | N,N-dimethyl-2-[1-methyl-3-(2-methylpropylidene)cyclobutyl]ethanamine;ethane |
|---|---|
| PubChem CID | 142581839 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | N,N-dimethyl-2-[1-methyl-3-(2-methylpropylidene)cyclobutyl]ethanamine;ethane |
| SMILES | CC.CC(C)C=C1CC(C)(CCN(C)C)C1 |
| InChI | InChI=1S/C13H25N.C2H6/c1-11(2)8-12-9-13(3,10-12)6-7-14(4)5;1-2/h8,11H,6-7,9-10H2,1-5H3;1-2H3/b12-8-; |
| InChIKey | YKUDZRVJJGHCTK-JCTPKUEWSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|