C13H25N — CID 142581840
N,N-dimethyl-2-[1-methyl-3-(2-methylpropylidene)cyclobutyl]ethanamine (PubChem CID 142581840) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is N,N-dimethyl-2-[1-methyl-3-(2-methylpropylidene)cyclobutyl]ethanamine.
| Compound Name | N,N-dimethyl-2-[1-methyl-3-(2-methylpropylidene)cyclobutyl]ethanamine |
|---|---|
| PubChem CID | 142581840 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | N,N-dimethyl-2-[1-methyl-3-(2-methylpropylidene)cyclobutyl]ethanamine |
| SMILES | CC(C)C=C1CC(C)(CCN(C)C)C1 |
| InChI | InChI=1S/C13H25N/c1-11(2)8-12-9-13(3,10-12)6-7-14(4)5/h8,11H,6-7,9-10H2,1-5H3/b12-8- |
| InChIKey | CZHGUSHDJXNZJV-WQLSENKSSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|