C28H35N5 — CID 142583548
N-[1-(3-ethylphenyl)ethenyl]-2-(3-methylimidazol-4-yl)-1,6-naphthyridin-7-amine;hexane (PubChem CID 142583548) has the molecular formula C28H35N5 and a molecular weight of 441.62 g/mol. Its IUPAC name is N-[1-(3-ethylphenyl)ethenyl]-2-(3-methylimidazol-4-yl)-1,6-naphthyridin-7-amine;hexane.
| Compound Name | N-[1-(3-ethylphenyl)ethenyl]-2-(3-methylimidazol-4-yl)-1,6-naphthyridin-7-amine;hexane |
|---|---|
| PubChem CID | 142583548 |
| Molecular Formula | C28H35N5 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | N-[1-(3-ethylphenyl)ethenyl]-2-(3-methylimidazol-4-yl)-1,6-naphthyridin-7-amine;hexane |
| SMILES | C=C(Nc1cc2nc(-c3cncn3C)ccc2cn1)c1cccc(CC)c1.CCCCCC |
| InChI | InChI=1S/C22H21N5.C6H14/c1-4-16-6-5-7-17(10-16)15(2)25-22-11-20-18(12-24-22)8-9-19(26-20)21-13-23-14-27(21)3;1-3-5-6-4-2/h5-14H,2,4H2,1,3H3,(H,24,25);3-6H2,1-2H3 |
| InChIKey | GQMGGSRUISWXKQ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|