C21H31N3 — CID 142599476
N-methyl-N'-(6,7,8-trimethyl-3-pent-1-en-2-ylquinolin-4-yl)propane-1,3-diamine (PubChem CID 142599476) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is N-methyl-N'-(6,7,8-trimethyl-3-pent-1-en-2-ylquinolin-4-yl)propane-1,3-diamine.
| Compound Name | N-methyl-N'-(6,7,8-trimethyl-3-pent-1-en-2-ylquinolin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 142599476 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | N-methyl-N'-(6,7,8-trimethyl-3-pent-1-en-2-ylquinolin-4-yl)propane-1,3-diamine |
| SMILES | C=C(CCC)c1cnc2c(C)c(C)c(C)cc2c1NCCCNC |
| InChI | InChI=1S/C21H31N3/c1-7-9-14(2)19-13-24-20-17(5)16(4)15(3)12-18(20)21(19)23-11-8-10-22-6/h12-13,22H,2,7-11H2,1,3-6H3,(H,23,24) |
| InChIKey | MJDZOLRHBIGFBY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|