C23H44N4O2 — CID 142602577
ethane;2-methoxypropan-2-ol;7-[4-(3-methylcyclobutyl)butan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 142602577) has the molecular formula C23H44N4O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is ethane;2-methoxypropan-2-ol;7-[4-(3-methylcyclobutyl)butan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | ethane;2-methoxypropan-2-ol;7-[4-(3-methylcyclobutyl)butan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142602577 |
| Molecular Formula | C23H44N4O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | ethane;2-methoxypropan-2-ol;7-[4-(3-methylcyclobutyl)butan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC.CC.CC1CC(CCC(C)n2ccc3c(N)ncnc32)C1.COC(C)(C)O |
| InChI | InChI=1S/C15H22N4.C4H10O2.2C2H6/c1-10-7-12(8-10)4-3-11(2)19-6-5-13-14(16)17-9-18-15(13)19;1-4(2,5)6-3;2*1-2/h5-6,9-12H,3-4,7-8H2,1-2H3,(H2,16,17,18);5H,1-3H3;2*1-2H3 |
| InChIKey | GOECINWKTRFPBP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|